About (3R)-4-azidobutane-1,3-diol
(3R)-4-azidobutane-1,3-diol (PubChem CID 130698557) has the molecular formula C4H9N3O2
and a molecular weight of 131.13 g/mol. Its IUPAC name is (3R)-4-azidobutane-1,3-diol.
Molecular Properties
| Compound Name | (3R)-4-azidobutane-1,3-diol |
| PubChem CID | 130698557 |
| Molecular Formula | C4H9N3O2 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | (3R)-4-azidobutane-1,3-diol |
| SMILES | [N-]=[N+]=NC[C@H](O)CCO |
| InChI | InChI=1S/C4H9N3O2/c5-7-6-3-4(9)1-2-8/h4,8-9H,1-3H2/t4-/m1/s1 |
| InChIKey | MKOAQYUZUSTOFJ-SCSAIBSYSA-N |
| XLogP | 0.04 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (3R)-4-azidobutane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-azidobutane-1,3-diol?
The IUPAC name of (3R)-4-azidobutane-1,3-diol (CID 130698557) is (3R)-4-azidobutane-1,3-diol.
What is the SMILES notation for (3R)-4-azidobutane-1,3-diol?
The canonical SMILES for (3R)-4-azidobutane-1,3-diol is [N-]=[N+]=NC[C@H](O)CCO.
What is the InChIKey of (3R)-4-azidobutane-1,3-diol?
The InChIKey is MKOAQYUZUSTOFJ-SCSAIBSYSA-N. The full InChI is InChI=1S/C4H9N3O2/c5-7-6-3-4(9)1-2-8/h4,8-9H,1-3H2/t4-/m1/s1.
What are the key properties of (3R)-4-azidobutane-1,3-diol?
(3R)-4-azidobutane-1,3-diol has a molecular weight of 131.13 g/mol, XLogP of 0.04, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-azidobutane-1,3-diol is sourced from PubChem (CID 130698557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).