C9H18N6O4 — CID 159544963
4-(azidomethyl)-2,2-dimethyl-1,3-dioxolane;3-azidopropane-1,2-diol (PubChem CID 159544963) has the molecular formula C9H18N6O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 4-(azidomethyl)-2,2-dimethyl-1,3-dioxolane;3-azidopropane-1,2-diol.
| Compound Name | 4-(azidomethyl)-2,2-dimethyl-1,3-dioxolane;3-azidopropane-1,2-diol |
|---|---|
| PubChem CID | 159544963 |
| Molecular Formula | C9H18N6O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-(azidomethyl)-2,2-dimethyl-1,3-dioxolane;3-azidopropane-1,2-diol |
| SMILES | CC1(C)OCC(CN=[N+]=[N-])O1.[N-]=[N+]=NCC(O)CO |
| InChI | InChI=1S/C6H11N3O2.C3H7N3O2/c1-6(2)10-4-5(11-6)3-8-9-7;4-6-5-1-3(8)2-7/h5H,3-4H2,1-2H3;3,7-8H,1-2H2 |
| InChIKey | MERLCVFGTVXYES-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 156.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|