C17H32O11 — CID 157365590
(2,2-dimethyl-1,3-dioxan-5-yl) formate;(2,2-dimethyl-1,3-dioxolan-4-yl)methyl formate;propane-1,2,3-triol (PubChem CID 157365590) has the molecular formula C17H32O11 and a molecular weight of 412.43 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxan-5-yl) formate;(2,2-dimethyl-1,3-dioxolan-4-yl)methyl formate;propane-1,2,3-triol.
| Compound Name | (2,2-dimethyl-1,3-dioxan-5-yl) formate;(2,2-dimethyl-1,3-dioxolan-4-yl)methyl formate;propane-1,2,3-triol |
|---|---|
| PubChem CID | 157365590 |
| Molecular Formula | C17H32O11 |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxan-5-yl) formate;(2,2-dimethyl-1,3-dioxolan-4-yl)methyl formate;propane-1,2,3-triol |
| SMILES | CC1(C)OCC(COC=O)O1.CC1(C)OCC(OC=O)CO1.OCC(O)CO |
| InChI | InChI=1S/2C7H12O4.C3H8O3/c1-7(2)10-3-6(4-11-7)9-5-8;1-7(2)10-4-6(11-7)3-9-5-8;4-1-3(6)2-5/h2*5-6H,3-4H2,1-2H3;3-6H,1-2H2 |
| InChIKey | BJDGEKHJPVJRPJ-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 150.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|