C16H32O9 — CID 66952472
2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 66952472) has the molecular formula C16H32O9 and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 66952472 |
| Molecular Formula | C16H32O9 |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | CC1(C)OCC(COC(CO)OCCOCCOCCOCCO)O1 |
| InChI | InChI=1S/C16H32O9/c1-16(2)24-13-14(25-16)12-23-15(11-18)22-10-9-21-8-7-20-6-5-19-4-3-17/h14-15,17-18H,3-13H2,1-2H3 |
| InChIKey | FAXDJWJAVNAMFA-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|