C9H17N3O5 — CID 118652031
(1R)-2-azido-1-[5,5-bis(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 118652031) has the molecular formula C9H17N3O5 and a molecular weight of 247.25 g/mol. Its IUPAC name is (1R)-2-azido-1-[5,5-bis(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | (1R)-2-azido-1-[5,5-bis(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 118652031 |
| Molecular Formula | C9H17N3O5 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (1R)-2-azido-1-[5,5-bis(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | CC1(C)OC([C@H](O)CN=[N+]=[N-])C(CO)(CO)O1 |
| InChI | InChI=1S/C9H17N3O5/c1-8(2)16-7(6(15)3-11-12-10)9(4-13,5-14)17-8/h6-7,13-15H,3-5H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | MTGNJIMTGSESMO-ULUSZKPHSA-N |
| XLogP | -0.47 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|