C13H21N3O7 — CID 129164140
ethyl (4S)-4-[(4R)-5-[(1R)-2-azido-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate (PubChem CID 129164140) has the molecular formula C13H21N3O7 and a molecular weight of 331.33 g/mol. Its IUPAC name is ethyl (4S)-4-[(4R)-5-[(1R)-2-azido-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate.
| Compound Name | ethyl (4S)-4-[(4R)-5-[(1R)-2-azido-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate |
|---|---|
| PubChem CID | 129164140 |
| Molecular Formula | C13H21N3O7 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | ethyl (4S)-4-[(4R)-5-[(1R)-2-azido-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate |
| SMILES | CCOC(=O)C(=O)C[C@H](O)[C@H]1OC(C)(C)OC1[C@H](O)CN=[N+]=[N-] |
| InChI | InChI=1S/C13H21N3O7/c1-4-21-12(20)8(18)5-7(17)10-11(9(19)6-15-16-14)23-13(2,3)22-10/h7,9-11,17,19H,4-6H2,1-3H3/t7-,9+,10+,11?/m0/s1 |
| InChIKey | ZKJPJHLTGZVOKJ-NCVFYZNSSA-N |
| XLogP | 0.06 |
| TPSA | 151.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|