C8H14N4O3 — CID 129164149
(1R)-2-azido-1-[(4R,5R)-5-methanimidoyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 129164149) has the molecular formula C8H14N4O3 and a molecular weight of 214.23 g/mol. Its IUPAC name is (1R)-2-azido-1-[(4R,5R)-5-methanimidoyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | (1R)-2-azido-1-[(4R,5R)-5-methanimidoyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 129164149 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (1R)-2-azido-1-[(4R,5R)-5-methanimidoyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | [H]/N=C/[C@H]1OC(C)(C)O[C@@H]1[C@H](O)CN=[N+]=[N-] |
| InChI | InChI=1S/C8H14N4O3/c1-8(2)14-6(3-9)7(15-8)5(13)4-11-12-10/h3,5-7,9,13H,4H2,1-2H3/b9-3+/t5-,6-,7-/m1/s1 |
| InChIKey | YAXSKMCPKNIAHX-VOSZQDFKSA-N |
| XLogP | 0.83 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|