C10H19N3O5 — CID 10467822
(1R)-2-azido-1-[(4R,5R)-5-(dimethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 10467822) has the molecular formula C10H19N3O5 and a molecular weight of 261.28 g/mol. Its IUPAC name is (1R)-2-azido-1-[(4R,5R)-5-(dimethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | (1R)-2-azido-1-[(4R,5R)-5-(dimethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 10467822 |
| Molecular Formula | C10H19N3O5 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (1R)-2-azido-1-[(4R,5R)-5-(dimethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | COC(OC)[C@@H]1OC(C)(C)O[C@@H]1[C@H](O)CN=[N+]=[N-] |
| InChI | InChI=1S/C10H19N3O5/c1-10(2)17-7(6(14)5-12-13-11)8(18-10)9(15-3)16-4/h6-9,14H,5H2,1-4H3/t6-,7-,8-/m1/s1 |
| InChIKey | JWIOBJOHMRPRPF-BWZBUEFSSA-N |
| XLogP | 0.80 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|