C14H23N3O6 — CID 129164259
ethyl 4-[(4R,5R)-5-[(1R)-2-azido-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-methylidenebutanoate (PubChem CID 129164259) has the molecular formula C14H23N3O6 and a molecular weight of 329.35 g/mol. Its IUPAC name is ethyl 4-[(4R,5R)-5-[(1R)-2-azido-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-methylidenebutanoate.
| Compound Name | ethyl 4-[(4R,5R)-5-[(1R)-2-azido-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 129164259 |
| Molecular Formula | C14H23N3O6 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | ethyl 4-[(4R,5R)-5-[(1R)-2-azido-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-methylidenebutanoate |
| SMILES | C=C(CC(O)[C@H]1OC(C)(C)O[C@@H]1[C@H](O)CN=[N+]=[N-])C(=O)OCC |
| InChI | InChI=1S/C14H23N3O6/c1-5-21-13(20)8(2)6-9(18)11-12(10(19)7-16-17-15)23-14(3,4)22-11/h9-12,18-19H,2,5-7H2,1,3-4H3/t9?,10-,11-,12-/m1/s1 |
| InChIKey | HTMBQOZOYXWKJC-OMQAKBTRSA-N |
| XLogP | 1.05 |
| TPSA | 133.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|