C13H23NO7 — CID 145311581
ethyl 4-[5-[(1R)-2-amino-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate (PubChem CID 145311581) has the molecular formula C13H23NO7 and a molecular weight of 305.33 g/mol. Its IUPAC name is ethyl 4-[5-[(1R)-2-amino-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate.
| Compound Name | ethyl 4-[5-[(1R)-2-amino-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate |
|---|---|
| PubChem CID | 145311581 |
| Molecular Formula | C13H23NO7 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | ethyl 4-[5-[(1R)-2-amino-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate |
| SMILES | CCOC(=O)C(=O)CC(O)C1OC(C)(C)OC1[C@H](O)CN |
| InChI | InChI=1S/C13H23NO7/c1-4-19-12(18)8(16)5-7(15)10-11(9(17)6-14)21-13(2,3)20-10/h7,9-11,15,17H,4-6,14H2,1-3H3/t7?,9-,10?,11?/m1/s1 |
| InChIKey | DMACDKQMHPSBFE-DOQBQQKUSA-N |
| XLogP | -1.29 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|