C17H25NaO10 — CID 44511278
sodium (4S)-4-[(4R,5R)-5-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate (PubChem CID 44511278) has the molecular formula C17H25NaO10 and a molecular weight of 412.37 g/mol. Its IUPAC name is sodium (4S)-4-[(4R,5R)-5-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate.
| Compound Name | sodium (4S)-4-[(4R,5R)-5-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate |
|---|---|
| PubChem CID | 44511278 |
| Molecular Formula | C17H25NaO10 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | sodium (4S)-4-[(4R,5R)-5-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate |
| SMILES | CC(=O)O[C@@H]([C@@H]1OC(C)(C)O[C@@H]1[C@@H](O)CC(=O)C(=O)[O-])[C@H]1COC(C)(C)O1.[Na+] |
| InChI | InChI=1S/C17H26O10.Na/c1-8(18)24-13(11-7-23-16(2,3)25-11)14-12(26-17(4,5)27-14)9(19)6-10(20)15(21)22;/h9,11-14,19H,6-7H2,1-5H3,(H,21,22);/q;+1/p-1/t9-,11+,12+,13+,14+;/m0./s1 |
| InChIKey | KUVNDEWKHVMKAV-IHQBAXAFSA-M |
| XLogP | -4.34 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|