C18H29N2O9+ — CID 11811776
(Z,3R)-3-[(4R,5R)-5-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethoxy-1,3-dihydroxyprop-1-ene-2-diazonium (PubChem CID 11811776) has the molecular formula C18H29N2O9+ and a molecular weight of 417.44 g/mol. Its IUPAC name is (Z,3R)-3-[(4R,5R)-5-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethoxy-1,3-dihydroxyprop-1-ene-2-diazonium.
| Compound Name | (Z,3R)-3-[(4R,5R)-5-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethoxy-1,3-dihydroxyprop-1-ene-2-diazonium |
|---|---|
| PubChem CID | 11811776 |
| Molecular Formula | C18H29N2O9+ |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (Z,3R)-3-[(4R,5R)-5-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethoxy-1,3-dihydroxyprop-1-ene-2-diazonium |
| SMILES | CCO/C(O)=C(\[N+]#N)[C@@H](O)[C@H]1OC(C)(C)O[C@H]1[C@H](OC(C)=O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H28N2O9/c1-7-24-16(23)11(20-19)12(22)14-15(29-18(5,6)28-14)13(26-9(2)21)10-8-25-17(3,4)27-10/h10,12-15,22H,7-8H2,1-6H3/p+1/b16-11-/t10-,12-,13-,14-,15+/m1/s1 |
| InChIKey | BGKBFFVUBJUIRU-WUEWZUKVSA-O |
| XLogP | 1.57 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|