C16H27N2O8+ — CID 11749151
(Z,3S)-3-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethoxy-1,3-dihydroxyprop-1-ene-2-diazonium (PubChem CID 11749151) has the molecular formula C16H27N2O8+ and a molecular weight of 375.40 g/mol. Its IUPAC name is (Z,3S)-3-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethoxy-1,3-dihydroxyprop-1-ene-2-diazonium.
| Compound Name | (Z,3S)-3-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethoxy-1,3-dihydroxyprop-1-ene-2-diazonium |
|---|---|
| PubChem CID | 11749151 |
| Molecular Formula | C16H27N2O8+ |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (Z,3S)-3-[(4R,5S)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethoxy-1,3-dihydroxyprop-1-ene-2-diazonium |
| SMILES | CCO/C(O)=C(\[N+]#N)[C@H](O)[C@H]1OC(C)(C)O[C@H]1[C@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H26N2O8/c1-6-22-14(21)9(18-17)11(20)13-12(25-16(4,5)26-13)10(19)8-7-23-15(2,3)24-8/h8,10-13,19-20H,6-7H2,1-5H3/p+1/b14-9-/t8-,10-,11+,12+,13-/m1/s1 |
| InChIKey | KAJRAOLJXYZFCX-ADEJNJSBSA-O |
| XLogP | 1.00 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|