C17H27N2O8+ — CID 11783993
(Z)-3-acetyloxy-3-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethoxy-1-hydroxyprop-1-ene-2-diazonium (PubChem CID 11783993) has the molecular formula C17H27N2O8+ and a molecular weight of 387.41 g/mol. Its IUPAC name is (Z)-3-acetyloxy-3-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethoxy-1-hydroxyprop-1-ene-2-diazonium.
| Compound Name | (Z)-3-acetyloxy-3-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethoxy-1-hydroxyprop-1-ene-2-diazonium |
|---|---|
| PubChem CID | 11783993 |
| Molecular Formula | C17H27N2O8+ |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (Z)-3-acetyloxy-3-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethoxy-1-hydroxyprop-1-ene-2-diazonium |
| SMILES | CCO/C(O)=C(\[N+]#N)C(OC(C)=O)[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H26N2O8/c1-7-22-15(21)11(19-18)13(24-9(2)20)14-12(26-17(5,6)27-14)10-8-23-16(3,4)25-10/h10,12-14H,7-8H2,1-6H3/p+1/b15-11-/t10-,12-,13?,14+/m1/s1 |
| InChIKey | DUCJJROEMNBGEK-CYKSCRAZSA-O |
| XLogP | 2.21 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|