C19H36O7Si — CID 15596056
ethyl 3-[(4R,5R)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 15596056) has the molecular formula C19H36O7Si and a molecular weight of 404.58 g/mol. Its IUPAC name is ethyl 3-[(4R,5R)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | ethyl 3-[(4R,5R)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 15596056 |
| Molecular Formula | C19H36O7Si |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | ethyl 3-[(4R,5R)-5-[(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | CCOC(=O)CC[C@H]1OC(C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H36O7Si/c1-9-21-15(20)11-10-13-16(25-19(4,5)23-13)17(26-27(6,7)8)14-12-22-18(2,3)24-14/h13-14,16-17H,9-12H2,1-8H3/t13-,14-,16-,17-/m1/s1 |
| InChIKey | LVJUJMSUYJOWDV-MUIFIZLQSA-N |
| XLogP | 3.22 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|