C15H24O5 — CID 122399240
ethyl (5S)-5-[(4R,5R)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-5-hydroxypent-2-ynoate (PubChem CID 122399240) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is ethyl (5S)-5-[(4R,5R)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-5-hydroxypent-2-ynoate.
| Compound Name | ethyl (5S)-5-[(4R,5R)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-5-hydroxypent-2-ynoate |
|---|---|
| PubChem CID | 122399240 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | ethyl (5S)-5-[(4R,5R)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-5-hydroxypent-2-ynoate |
| SMILES | CCC[C@H]1OC(C)(C)O[C@@H]1[C@@H](O)CC#CC(=O)OCC |
| InChI | InChI=1S/C15H24O5/c1-5-8-12-14(20-15(3,4)19-12)11(16)9-7-10-13(17)18-6-2/h11-12,14,16H,5-6,8-9H2,1-4H3/t11-,12+,14+/m0/s1 |
| InChIKey | LGWGEQUWGOWVHD-OUCADQQQSA-N |
| XLogP | 1.62 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|