About 1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol
1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol (PubChem CID 18740051) has the molecular formula C11H22O6
and a molecular weight of 250.29 g/mol. Its IUPAC name is 1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol.
Molecular Properties
| Compound Name | 1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol |
| PubChem CID | 18740051 |
| Molecular Formula | C11H22O6 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol |
| SMILES | COCC(O)C1OC(C)(C)OC1C(O)COC |
| InChI | InChI=1S/C11H22O6/c1-11(2)16-9(7(12)5-14-3)10(17-11)8(13)6-15-4/h7-10,12-13H,5-6H2,1-4H3 |
| InChIKey | PIJWIYAQEHVZPS-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol?
The IUPAC name of 1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol (CID 18740051) is 1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol.
What is the SMILES notation for 1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol?
The canonical SMILES for 1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol is COCC(O)C1OC(C)(C)OC1C(O)COC.
What is the InChIKey of 1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol?
The InChIKey is PIJWIYAQEHVZPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O6/c1-11(2)16-9(7(12)5-14-3)10(17-11)8(13)6-15-4/h7-10,12-13H,5-6H2,1-4H3.
What are the key properties of 1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol?
1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol has a molecular weight of 250.29 g/mol, XLogP of -0.48, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(1-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyethanol is sourced from PubChem (CID 18740051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).