C9H16Br2O4 — CID 102273421
(2S)-2-bromo-2-[(4S,5R)-5-[(1R)-2-bromo-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 102273421) has the molecular formula C9H16Br2O4 and a molecular weight of 348.03 g/mol. Its IUPAC name is (2S)-2-bromo-2-[(4S,5R)-5-[(1R)-2-bromo-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | (2S)-2-bromo-2-[(4S,5R)-5-[(1R)-2-bromo-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 102273421 |
| Molecular Formula | C9H16Br2O4 |
| Molecular Weight | 348.03 g/mol |
| Exact Mass | 345.94 |
| IUPAC Name | (2S)-2-bromo-2-[(4S,5R)-5-[(1R)-2-bromo-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | CC1(C)O[C@H]([C@@H](O)CBr)[C@@H]([C@@H](Br)CO)O1 |
| InChI | InChI=1S/C9H16Br2O4/c1-9(2)14-7(5(11)4-12)8(15-9)6(13)3-10/h5-8,12-13H,3-4H2,1-2H3/t5-,6-,7+,8+/m0/s1 |
| InChIKey | ZLYCCEZILUPBEH-RULNZFCNSA-N |
| XLogP | 1.02 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.03 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|