C16H24N4O6S — CID 11418157
N-[(1R)-2-azido-1-[(4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-4-methylbenzenesulfonamide (PubChem CID 11418157) has the molecular formula C16H24N4O6S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-[(1R)-2-azido-1-[(4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R)-2-azido-1-[(4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11418157 |
| Molecular Formula | C16H24N4O6S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-[(1R)-2-azido-1-[(4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](CN=[N+]=[N-])[C@H]2OC(C)(C)O[C@@H]2[C@H](O)CO)cc1 |
| InChI | InChI=1S/C16H24N4O6S/c1-10-4-6-11(7-5-10)27(23,24)19-12(8-18-20-17)14-15(13(22)9-21)26-16(2,3)25-14/h4-7,12-15,19,21-22H,8-9H2,1-3H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | LGQLGSAEDNCAGQ-KBUPBQIOSA-N |
| XLogP | 0.83 |
| TPSA | 153.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|