C25H44O6SSi — CID 101221755
2-[(4S,5R)-5-[(1S)-2-hydroxy-1-tri(propan-2-yl)silylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 101221755) has the molecular formula C25H44O6SSi and a molecular weight of 500.77 g/mol. Its IUPAC name is 2-[(4S,5R)-5-[(1S)-2-hydroxy-1-tri(propan-2-yl)silylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(4S,5R)-5-[(1S)-2-hydroxy-1-tri(propan-2-yl)silylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101221755 |
| Molecular Formula | C25H44O6SSi |
| Molecular Weight | 500.77 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | 2-[(4S,5R)-5-[(1S)-2-hydroxy-1-tri(propan-2-yl)silylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@@H]2OC(C)(C)O[C@H]2[C@H](CO)[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C25H44O6SSi/c1-17(2)33(18(3)4,19(5)6)23(16-26)24-22(30-25(8,9)31-24)14-15-29-32(27,28)21-12-10-20(7)11-13-21/h10-13,17-19,22-24,26H,14-16H2,1-9H3/t22-,23-,24+/m0/s1 |
| InChIKey | ZFZQMGIDDGGPLW-KMDXXIMOSA-N |
| XLogP | 5.65 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.77 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|