C19H26O7S — CID 88913777
2-[(1R,6R,8R,9S)-8-hydroxy-4,4-dimethyl-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 88913777) has the molecular formula C19H26O7S and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[(1R,6R,8R,9S)-8-hydroxy-4,4-dimethyl-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(1R,6R,8R,9S)-8-hydroxy-4,4-dimethyl-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88913777 |
| Molecular Formula | C19H26O7S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-[(1R,6R,8R,9S)-8-hydroxy-4,4-dimethyl-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@@H]2O[C@@H]3C[C@@]2(O)C[C@H]2OC(C)(C)OC32)cc1 |
| InChI | InChI=1S/C19H26O7S/c1-12-4-6-13(7-5-12)27(21,22)23-9-8-16-19(20)10-14(24-16)17-15(11-19)25-18(2,3)26-17/h4-7,14-17,20H,8-11H2,1-3H3/t14-,15-,16+,17?,19-/m1/s1 |
| InChIKey | MYMPLWMHQOBUDB-RDCJPKHASA-N |
| XLogP | 1.90 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|