C18H21N3O7S2 — CID 101253626
[(2R,3S)-4-azido-3-hydroxy-2-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate (PubChem CID 101253626) has the molecular formula C18H21N3O7S2 and a molecular weight of 455.51 g/mol. Its IUPAC name is [(2R,3S)-4-azido-3-hydroxy-2-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-4-azido-3-hydroxy-2-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101253626 |
| Molecular Formula | C18H21N3O7S2 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | [(2R,3S)-4-azido-3-hydroxy-2-(4-methylphenyl)sulfonyloxybutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H](O)CN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C18H21N3O7S2/c1-13-3-7-15(8-4-13)29(23,24)27-12-18(17(22)11-20-21-19)28-30(25,26)16-9-5-14(2)6-10-16/h3-10,17-18,22H,11-12H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | DRPHPRRWQNHKFK-ZWKOTPCHSA-N |
| XLogP | 2.45 |
| TPSA | 155.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|