C18H21N3O10S3 — CID 11092710
[(2S,3S)-2-azido-4-(4-methylphenyl)sulfonyloxy-3-sulfooxybutyl] 4-methylbenzenesulfonate (PubChem CID 11092710) has the molecular formula C18H21N3O10S3 and a molecular weight of 535.58 g/mol. Its IUPAC name is [(2S,3S)-2-azido-4-(4-methylphenyl)sulfonyloxy-3-sulfooxybutyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S)-2-azido-4-(4-methylphenyl)sulfonyloxy-3-sulfooxybutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11092710 |
| Molecular Formula | C18H21N3O10S3 |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | [(2S,3S)-2-azido-4-(4-methylphenyl)sulfonyloxy-3-sulfooxybutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](N=[N+]=[N-])[C@@H](COS(=O)(=O)c2ccc(C)cc2)OS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H21N3O10S3/c1-13-3-7-15(8-4-13)32(22,23)29-11-17(20-21-19)18(31-34(26,27)28)12-30-33(24,25)16-9-5-14(2)6-10-16/h3-10,17-18H,11-12H2,1-2H3,(H,26,27,28)/t17-,18+/m0/s1 |
| InChIKey | VONXMVBMZVHDNK-ZWKOTPCHSA-N |
| XLogP | 2.28 |
| TPSA | 199.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|