C18H29N5O4S — CID 44575117
tert-butyl N-[(5S)-6-azido-5-[(4-methylphenyl)sulfonylamino]hexyl]carbamate (PubChem CID 44575117) has the molecular formula C18H29N5O4S and a molecular weight of 411.53 g/mol. Its IUPAC name is tert-butyl N-[(5S)-6-azido-5-[(4-methylphenyl)sulfonylamino]hexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-6-azido-5-[(4-methylphenyl)sulfonylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 44575117 |
| Molecular Formula | C18H29N5O4S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | tert-butyl N-[(5S)-6-azido-5-[(4-methylphenyl)sulfonylamino]hexyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)CN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C18H29N5O4S/c1-14-8-10-16(11-9-14)28(25,26)22-15(13-21-23-19)7-5-6-12-20-17(24)27-18(2,3)4/h8-11,15,22H,5-7,12-13H2,1-4H3,(H,20,24)/t15-/m0/s1 |
| InChIKey | DXHLJIBOHVIPMG-HNNXBMFYSA-N |
| XLogP | 3.65 |
| TPSA | 133.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|