C4H7N4O3- — CID 135081181
(2R,3S)-2-amino-4-azido-3-hydroxybutanoate (PubChem CID 135081181) has the molecular formula C4H7N4O3- and a molecular weight of 159.12 g/mol. Its IUPAC name is (2R,3S)-2-amino-4-azido-3-hydroxybutanoate.
| Compound Name | (2R,3S)-2-amino-4-azido-3-hydroxybutanoate |
|---|---|
| PubChem CID | 135081181 |
| Molecular Formula | C4H7N4O3- |
| Molecular Weight | 159.12 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | (2R,3S)-2-amino-4-azido-3-hydroxybutanoate |
| SMILES | [N-]=[N+]=NC[C@H](O)[C@@H](N)C(=O)[O-] |
| InChI | InChI=1S/C4H8N4O3/c5-3(4(10)11)2(9)1-7-8-6/h2-3,9H,1,5H2,(H,10,11)/p-1/t2-,3+/m0/s1 |
| InChIKey | GALQPZIJMDZEKC-STHAYSLISA-M |
| XLogP | -2.27 |
| TPSA | 135.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.12 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|