C7H13N3O5 — CID 54353674
1-azido-4,5,6-trihydroxy-2-methoxyhexan-3-one (PubChem CID 54353674) has the molecular formula C7H13N3O5 and a molecular weight of 219.20 g/mol. Its IUPAC name is 1-azido-4,5,6-trihydroxy-2-methoxyhexan-3-one.
| Compound Name | 1-azido-4,5,6-trihydroxy-2-methoxyhexan-3-one |
|---|---|
| PubChem CID | 54353674 |
| Molecular Formula | C7H13N3O5 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 1-azido-4,5,6-trihydroxy-2-methoxyhexan-3-one |
| SMILES | COC(CN=[N+]=[N-])C(=O)C(O)C(O)CO |
| InChI | InChI=1S/C7H13N3O5/c1-15-5(2-9-10-8)7(14)6(13)4(12)3-11/h4-6,11-13H,2-3H2,1H3 |
| InChIKey | UHOVBPUOTRBDBH-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 135.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|