About 2-hydroxyheptanedioyl diazide
2-hydroxyheptanedioyl diazide (PubChem CID 142790693) has the molecular formula C7H10N6O3
and a molecular weight of 226.20 g/mol. Its IUPAC name is 2-hydroxyheptanedioyl diazide.
Molecular Properties
| Compound Name | 2-hydroxyheptanedioyl diazide |
| PubChem CID | 142790693 |
| Molecular Formula | C7H10N6O3 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-hydroxyheptanedioyl diazide |
| SMILES | [N-]=[N+]=NC(=O)CCCCC(O)C(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C7H10N6O3/c8-12-10-6(15)4-2-1-3-5(14)7(16)11-13-9/h5,14H,1-4H2 |
| InChIKey | STMWDIWCVGSIMA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 151.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyheptanedioyl diazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyheptanedioyl diazide?
The IUPAC name of 2-hydroxyheptanedioyl diazide (CID 142790693) is 2-hydroxyheptanedioyl diazide.
What is the SMILES notation for 2-hydroxyheptanedioyl diazide?
The canonical SMILES for 2-hydroxyheptanedioyl diazide is [N-]=[N+]=NC(=O)CCCCC(O)C(=O)N=[N+]=[N-].
What is the InChIKey of 2-hydroxyheptanedioyl diazide?
The InChIKey is STMWDIWCVGSIMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6O3/c8-12-10-6(15)4-2-1-3-5(14)7(16)11-13-9/h5,14H,1-4H2.
What are the key properties of 2-hydroxyheptanedioyl diazide?
2-hydroxyheptanedioyl diazide has a molecular weight of 226.20 g/mol, XLogP of 1.58, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyheptanedioyl diazide is sourced from PubChem (CID 142790693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).