C8H19NO4Si — CID 72527433
2,3,4-trihydroxy-N-(trimethylsilylmethyl)butanamide (PubChem CID 72527433) has the molecular formula C8H19NO4Si and a molecular weight of 221.33 g/mol. Its IUPAC name is 2,3,4-trihydroxy-N-(trimethylsilylmethyl)butanamide.
| Compound Name | 2,3,4-trihydroxy-N-(trimethylsilylmethyl)butanamide |
|---|---|
| PubChem CID | 72527433 |
| Molecular Formula | C8H19NO4Si |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2,3,4-trihydroxy-N-(trimethylsilylmethyl)butanamide |
| SMILES | C[Si](C)(C)CNC(=O)C(O)C(O)CO |
| InChI | InChI=1S/C8H19NO4Si/c1-14(2,3)5-9-8(13)7(12)6(11)4-10/h6-7,10-12H,4-5H2,1-3H3,(H,9,13) |
| InChIKey | JJMVTTCLJKDEIK-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|