C8H14O4 — CID 142665515
(E)-5,6,7-trihydroxy-3-methylhept-2-en-4-one (PubChem CID 142665515) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is (E)-5,6,7-trihydroxy-3-methylhept-2-en-4-one.
| Compound Name | (E)-5,6,7-trihydroxy-3-methylhept-2-en-4-one |
|---|---|
| PubChem CID | 142665515 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (E)-5,6,7-trihydroxy-3-methylhept-2-en-4-one |
| SMILES | C/C=C(\C)C(=O)C(O)C(O)CO |
| InChI | InChI=1S/C8H14O4/c1-3-5(2)7(11)8(12)6(10)4-9/h3,6,8-10,12H,4H2,1-2H3/b5-3+ |
| InChIKey | PFNMGFQUHONPNW-HWKANZROSA-N |
| XLogP | -0.76 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|