C5H9NO6 — CID 54377470
(3S,4R)-N,3,4,5-tetrahydroxy-2-oxopentanamide (PubChem CID 54377470) has the molecular formula C5H9NO6 and a molecular weight of 179.13 g/mol. Its IUPAC name is (3S,4R)-N,3,4,5-tetrahydroxy-2-oxopentanamide.
| Compound Name | (3S,4R)-N,3,4,5-tetrahydroxy-2-oxopentanamide |
|---|---|
| PubChem CID | 54377470 |
| Molecular Formula | C5H9NO6 |
| Molecular Weight | 179.13 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | (3S,4R)-N,3,4,5-tetrahydroxy-2-oxopentanamide |
| SMILES | O=C(NO)C(=O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C5H9NO6/c7-1-2(8)3(9)4(10)5(11)6-12/h2-3,7-9,12H,1H2,(H,6,11)/t2-,3+/m1/s1 |
| InChIKey | ANRAFCPDLDRTDZ-GBXIJSLDSA-N |
| XLogP | -3.22 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.13 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|