C7H11NO7 — CID 57016489
(3S,4R,5R)-N-formyl-3,4,5,6-tetrahydroxy-2-oxohexanamide (PubChem CID 57016489) has the molecular formula C7H11NO7 and a molecular weight of 221.16 g/mol. Its IUPAC name is (3S,4R,5R)-N-formyl-3,4,5,6-tetrahydroxy-2-oxohexanamide.
| Compound Name | (3S,4R,5R)-N-formyl-3,4,5,6-tetrahydroxy-2-oxohexanamide |
|---|---|
| PubChem CID | 57016489 |
| Molecular Formula | C7H11NO7 |
| Molecular Weight | 221.16 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | (3S,4R,5R)-N-formyl-3,4,5,6-tetrahydroxy-2-oxohexanamide |
| SMILES | O=CNC(=O)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H11NO7/c9-1-3(11)4(12)5(13)6(14)7(15)8-2-10/h2-5,9,11-13H,1H2,(H,8,10,15)/t3-,4-,5+/m1/s1 |
| InChIKey | CWFAGTQMFQVULB-WDCZJNDASA-N |
| XLogP | -4.10 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.16 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|