C19H35NO5 — CID 166523783
(2S)-2-amino-3-tetradecanoylpentanedioic acid (PubChem CID 166523783) has the molecular formula C19H35NO5 and a molecular weight of 357.49 g/mol. Its IUPAC name is (2S)-2-amino-3-tetradecanoylpentanedioic acid.
| Compound Name | (2S)-2-amino-3-tetradecanoylpentanedioic acid |
|---|---|
| PubChem CID | 166523783 |
| Molecular Formula | C19H35NO5 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | (2S)-2-amino-3-tetradecanoylpentanedioic acid |
| SMILES | CCCCCCCCCCCCCC(=O)C(CC(=O)O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C19H35NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(21)15(14-17(22)23)18(20)19(24)25/h15,18H,2-14,20H2,1H3,(H,22,23)(H,24,25)/t15?,18-/m0/s1 |
| InChIKey | FBYMZZYUANYJAG-PKHIMPSTSA-N |
| XLogP | 3.76 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|