C18H35NO4 — CID 174767583
(2S,3R)-2-amino-3-hydroxy-5-oxooctadecanoic acid (PubChem CID 174767583) has the molecular formula C18H35NO4 and a molecular weight of 329.48 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-hydroxy-5-oxooctadecanoic acid.
| Compound Name | (2S,3R)-2-amino-3-hydroxy-5-oxooctadecanoic acid |
|---|---|
| PubChem CID | 174767583 |
| Molecular Formula | C18H35NO4 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | (2S,3R)-2-amino-3-hydroxy-5-oxooctadecanoic acid |
| SMILES | CCCCCCCCCCCCCC(=O)C[C@@H](O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C18H35NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15(20)14-16(21)17(19)18(22)23/h16-17,21H,2-14,19H2,1H3,(H,22,23)/t16-,17+/m1/s1 |
| InChIKey | VAIMTYNIPKJSCK-SJORKVTESA-N |
| XLogP | 3.42 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|