C16H31NO5 — CID 87665876
(2R,3R,4R,5R)-2-amino-3,4,5-trihydroxy-7-oxohexadecanal (PubChem CID 87665876) has the molecular formula C16H31NO5 and a molecular weight of 317.43 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-amino-3,4,5-trihydroxy-7-oxohexadecanal.
| Compound Name | (2R,3R,4R,5R)-2-amino-3,4,5-trihydroxy-7-oxohexadecanal |
|---|---|
| PubChem CID | 87665876 |
| Molecular Formula | C16H31NO5 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | (2R,3R,4R,5R)-2-amino-3,4,5-trihydroxy-7-oxohexadecanal |
| SMILES | CCCCCCCCCC(=O)C[C@@H](O)[C@@H](O)[C@H](O)[C@@H](N)C=O |
| InChI | InChI=1S/C16H31NO5/c1-2-3-4-5-6-7-8-9-12(19)10-14(20)16(22)15(21)13(17)11-18/h11,13-16,20-22H,2-10,17H2,1H3/t13-,14+,15+,16+/m0/s1 |
| InChIKey | ZNGMGKXFTOGUPC-ZJIFWQFVSA-N |
| XLogP | 0.70 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|