About 4-aminotridecan-6-one
4-aminotridecan-6-one (PubChem CID 116607784) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is 4-aminotridecan-6-one.
Molecular Properties
| Compound Name | 4-aminotridecan-6-one |
| PubChem CID | 116607784 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 4-aminotridecan-6-one |
| SMILES | CCCCCCCC(=O)CC(N)CCC |
| InChI | InChI=1S/C13H27NO/c1-3-5-6-7-8-10-13(15)11-12(14)9-4-2/h12H,3-11,14H2,1-2H3 |
| InChIKey | HBMWPQCULWZZLH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-aminotridecan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminotridecan-6-one?
The IUPAC name of 4-aminotridecan-6-one (CID 116607784) is 4-aminotridecan-6-one.
What is the SMILES notation for 4-aminotridecan-6-one?
The canonical SMILES for 4-aminotridecan-6-one is CCCCCCCC(=O)CC(N)CCC.
What is the InChIKey of 4-aminotridecan-6-one?
The InChIKey is HBMWPQCULWZZLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-3-5-6-7-8-10-13(15)11-12(14)9-4-2/h12H,3-11,14H2,1-2H3.
What are the key properties of 4-aminotridecan-6-one?
4-aminotridecan-6-one has a molecular weight of 213.36 g/mol, XLogP of 3.43, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminotridecan-6-one is sourced from PubChem (CID 116607784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).