About (2-amino-4-oxotridecyl) acetate
(2-amino-4-oxotridecyl) acetate (PubChem CID 161199425) has the molecular formula C15H29NO3
and a molecular weight of 271.40 g/mol. Its IUPAC name is (2-amino-4-oxotridecyl) acetate.
Molecular Properties
| Compound Name | (2-amino-4-oxotridecyl) acetate |
| PubChem CID | 161199425 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | (2-amino-4-oxotridecyl) acetate |
| SMILES | CCCCCCCCCC(=O)CC(N)COC(C)=O |
| InChI | InChI=1S/C15H29NO3/c1-3-4-5-6-7-8-9-10-15(18)11-14(16)12-19-13(2)17/h14H,3-12,16H2,1-2H3 |
| InChIKey | WEYUMYLANXENAI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-4-oxotridecyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4-oxotridecyl) acetate?
The IUPAC name of (2-amino-4-oxotridecyl) acetate (CID 161199425) is (2-amino-4-oxotridecyl) acetate.
What is the SMILES notation for (2-amino-4-oxotridecyl) acetate?
The canonical SMILES for (2-amino-4-oxotridecyl) acetate is CCCCCCCCCC(=O)CC(N)COC(C)=O.
What is the InChIKey of (2-amino-4-oxotridecyl) acetate?
The InChIKey is WEYUMYLANXENAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO3/c1-3-4-5-6-7-8-9-10-15(18)11-14(16)12-19-13(2)17/h14H,3-12,16H2,1-2H3.
What are the key properties of (2-amino-4-oxotridecyl) acetate?
(2-amino-4-oxotridecyl) acetate has a molecular weight of 271.40 g/mol, XLogP of 2.98, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4-oxotridecyl) acetate is sourced from PubChem (CID 161199425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).