About ethyl acetate;octan-3-one
ethyl acetate;octan-3-one (PubChem CID 138620784) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is ethyl acetate;octan-3-one.
Molecular Properties
| Compound Name | ethyl acetate;octan-3-one |
| PubChem CID | 138620784 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | ethyl acetate;octan-3-one |
| SMILES | CCCCCC(=O)CC.CCOC(C)=O |
| InChI | InChI=1S/C8H16O.C4H8O2/c1-3-5-6-7-8(9)4-2;1-3-6-4(2)5/h3-7H2,1-2H3;3H2,1-2H3 |
| InChIKey | ZSYSQCFEIOKEQF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl acetate;octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;octan-3-one?
The IUPAC name of ethyl acetate;octan-3-one (CID 138620784) is ethyl acetate;octan-3-one.
What is the SMILES notation for ethyl acetate;octan-3-one?
The canonical SMILES for ethyl acetate;octan-3-one is CCCCCC(=O)CC.CCOC(C)=O.
What is the InChIKey of ethyl acetate;octan-3-one?
The InChIKey is ZSYSQCFEIOKEQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C4H8O2/c1-3-5-6-7-8(9)4-2;1-3-6-4(2)5/h3-7H2,1-2H3;3H2,1-2H3.
What are the key properties of ethyl acetate;octan-3-one?
ethyl acetate;octan-3-one has a molecular weight of 216.32 g/mol, XLogP of 3.12, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;octan-3-one is sourced from PubChem (CID 138620784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).