About diethyl oxalate;heptan-3-one
diethyl oxalate;heptan-3-one (PubChem CID 174811916) has the molecular formula C13H24O5
and a molecular weight of 260.33 g/mol. Its IUPAC name is diethyl oxalate;heptan-3-one.
Molecular Properties
| Compound Name | diethyl oxalate;heptan-3-one |
| PubChem CID | 174811916 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | diethyl oxalate;heptan-3-one |
| SMILES | CCCCC(=O)CC.CCOC(=O)C(=O)OCC |
| InChI | InChI=1S/C7H14O.C6H10O4/c1-3-5-6-7(8)4-2;1-3-9-5(7)6(8)10-4-2/h3-6H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | HYEVDQOWOKWPDG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze diethyl oxalate;heptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl oxalate;heptan-3-one?
The IUPAC name of diethyl oxalate;heptan-3-one (CID 174811916) is diethyl oxalate;heptan-3-one.
What is the SMILES notation for diethyl oxalate;heptan-3-one?
The canonical SMILES for diethyl oxalate;heptan-3-one is CCCCC(=O)CC.CCOC(=O)C(=O)OCC.
What is the InChIKey of diethyl oxalate;heptan-3-one?
The InChIKey is HYEVDQOWOKWPDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C6H10O4/c1-3-5-6-7(8)4-2;1-3-9-5(7)6(8)10-4-2/h3-6H2,1-2H3;3-4H2,1-2H3.
What are the key properties of diethyl oxalate;heptan-3-one?
diethyl oxalate;heptan-3-one has a molecular weight of 260.33 g/mol, XLogP of 2.27, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl oxalate;heptan-3-one is sourced from PubChem (CID 174811916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).