About 4-oxoundecan-2-yl acetate
4-oxoundecan-2-yl acetate (PubChem CID 12807123) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is 4-oxoundecan-2-yl acetate.
Molecular Properties
| Compound Name | 4-oxoundecan-2-yl acetate |
| PubChem CID | 12807123 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 4-oxoundecan-2-yl acetate |
| SMILES | CCCCCCCC(=O)CC(C)OC(C)=O |
| InChI | InChI=1S/C13H24O3/c1-4-5-6-7-8-9-13(15)10-11(2)16-12(3)14/h11H,4-10H2,1-3H3 |
| InChIKey | NLRYSBQSHMIYAV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-oxoundecan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxoundecan-2-yl acetate?
The IUPAC name of 4-oxoundecan-2-yl acetate (CID 12807123) is 4-oxoundecan-2-yl acetate.
What is the SMILES notation for 4-oxoundecan-2-yl acetate?
The canonical SMILES for 4-oxoundecan-2-yl acetate is CCCCCCCC(=O)CC(C)OC(C)=O.
What is the InChIKey of 4-oxoundecan-2-yl acetate?
The InChIKey is NLRYSBQSHMIYAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-4-5-6-7-8-9-13(15)10-11(2)16-12(3)14/h11H,4-10H2,1-3H3.
What are the key properties of 4-oxoundecan-2-yl acetate?
4-oxoundecan-2-yl acetate has a molecular weight of 228.33 g/mol, XLogP of 3.26, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxoundecan-2-yl acetate is sourced from PubChem (CID 12807123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).