C7H11NO3 — CID 101418719
(3S)-4-cyano-3-hydroxy-4-methylpentanoic acid (PubChem CID 101418719) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is (3S)-4-cyano-3-hydroxy-4-methylpentanoic acid.
| Compound Name | (3S)-4-cyano-3-hydroxy-4-methylpentanoic acid |
|---|---|
| PubChem CID | 101418719 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (3S)-4-cyano-3-hydroxy-4-methylpentanoic acid |
| SMILES | CC(C)(C#N)[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C7H11NO3/c1-7(2,4-8)5(9)3-6(10)11/h5,9H,3H2,1-2H3,(H,10,11)/t5-/m0/s1 |
| InChIKey | OVJOEASUMUOPSJ-YFKPBYRVSA-N |
| XLogP | 0.37 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |