C13H27NOSi — CID 23567931
(3S)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile (PubChem CID 23567931) has the molecular formula C13H27NOSi and a molecular weight of 241.45 g/mol. Its IUPAC name is (3S)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile.
| Compound Name | (3S)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 23567931 |
| Molecular Formula | C13H27NOSi |
| Molecular Weight | 241.45 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | (3S)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)[C@@H](O)CC[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H27NOSi/c1-12(2,3)16(6,7)9-8-11(15)13(4,5)10-14/h11,15H,8-9H2,1-7H3/t11-/m0/s1 |
| InChIKey | JTIVXYLIIJDSIO-NSHDSACASA-N |
| XLogP | 3.80 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|