C10H16N2O — CID 166777724
(3S)-3-hydroxy-2,2,5,5-tetramethylhexanedinitrile (PubChem CID 166777724) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (3S)-3-hydroxy-2,2,5,5-tetramethylhexanedinitrile.
| Compound Name | (3S)-3-hydroxy-2,2,5,5-tetramethylhexanedinitrile |
|---|---|
| PubChem CID | 166777724 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (3S)-3-hydroxy-2,2,5,5-tetramethylhexanedinitrile |
| SMILES | CC(C)(C#N)C[C@H](O)C(C)(C)C#N |
| InChI | InChI=1S/C10H16N2O/c1-9(2,6-11)5-8(13)10(3,4)7-12/h8,13H,5H2,1-4H3/t8-/m0/s1 |
| InChIKey | KILOZXWBGYSOAX-QMMMGPOBSA-N |
| XLogP | 1.84 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |