About 2,2-dimethylbutanenitrile;2,2-dimethylpropanenitrile
2,2-dimethylbutanenitrile;2,2-dimethylpropanenitrile (PubChem CID 159256086) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 2,2-dimethylbutanenitrile;2,2-dimethylpropanenitrile.
Analyze 2,2-dimethylbutanenitrile;2,2-dimethylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylbutanenitrile;2,2-dimethylpropanenitrile?
The IUPAC name of 2,2-dimethylbutanenitrile;2,2-dimethylpropanenitrile (CID 159256086) is 2,2-dimethylbutanenitrile;2,2-dimethylpropanenitrile.
What is the SMILES notation for 2,2-dimethylbutanenitrile;2,2-dimethylpropanenitrile?
The canonical SMILES for 2,2-dimethylbutanenitrile;2,2-dimethylpropanenitrile is CC(C)(C)C#N.CCC(C)(C)C#N.
What is the InChIKey of 2,2-dimethylbutanenitrile;2,2-dimethylpropanenitrile?
The InChIKey is KVXLBLNSIUSXLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.C5H9N/c1-4-6(2,3)5-7;1-5(2,3)4-6/h4H2,1-3H3;1-3H3.
What are the key properties of 2,2-dimethylbutanenitrile;2,2-dimethylpropanenitrile?
2,2-dimethylbutanenitrile;2,2-dimethylpropanenitrile has a molecular weight of 180.29 g/mol, XLogP of 3.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylbutanenitrile;2,2-dimethylpropanenitrile is sourced from PubChem (CID 159256086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).