C6H15NO4Si — CID 175510249
2,2-dimethylbutanenitrile;silicic acid (PubChem CID 175510249) has the molecular formula C6H15NO4Si and a molecular weight of 193.27 g/mol. Its IUPAC name is 2,2-dimethylbutanenitrile;silicic acid.
| Compound Name | 2,2-dimethylbutanenitrile;silicic acid |
|---|---|
| PubChem CID | 175510249 |
| Molecular Formula | C6H15NO4Si |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | 2,2-dimethylbutanenitrile;silicic acid |
| SMILES | CCC(C)(C)C#N.O[Si](O)(O)O |
| InChI | InChI=1S/C6H11N.H4O4Si/c1-4-6(2,3)5-7;1-5(2,3)4/h4H2,1-3H3;1-4H |
| InChIKey | XDXNOAHSSFTMLD-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|