2,2-dimethylbutanenitrile;silicic acid

C6H15NO4Si — CID 175510249

IUPAC2,2-dimethylbutanenitrile;silicic acid
SMILESCCC(C)(C)C#N.O[Si](O)(O)O
InChIInChI=1S/C6H11N.H4O4Si/c1-4-6(2,3)5-7;1-5(2,3)4/h4H2,1-3H3;1-4H
InChIKeyXDXNOAHSSFTMLD-UHFFFAOYSA-N
MW193.27 g/mol
LogP-0.66
Rot. Bonds1

About 2,2-dimethylbutanenitrile;silicic acid

2,2-dimethylbutanenitrile;silicic acid (PubChem CID 175510249) has the molecular formula C6H15NO4Si and a molecular weight of 193.27 g/mol. Its IUPAC name is 2,2-dimethylbutanenitrile;silicic acid.

Molecular Properties

Compound Name2,2-dimethylbutanenitrile;silicic acid
PubChem CID175510249
Molecular FormulaC6H15NO4Si
Molecular Weight193.27 g/mol
Exact Mass193.08
IUPAC Name2,2-dimethylbutanenitrile;silicic acid
SMILESCCC(C)(C)C#N.O[Si](O)(O)O
InChIInChI=1S/C6H11N.H4O4Si/c1-4-6(2,3)5-7;1-5(2,3)4/h4H2,1-3H3;1-4H
InChIKeyXDXNOAHSSFTMLD-UHFFFAOYSA-N
XLogP-0.66
TPSA104.71 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.27
LogP ≤ 5-0.66
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 2,2-dimethylbutanenitrile;silicic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethylbutanenitrile;silicic acid?
The IUPAC name of 2,2-dimethylbutanenitrile;silicic acid (CID 175510249) is 2,2-dimethylbutanenitrile;silicic acid.
What is the SMILES notation for 2,2-dimethylbutanenitrile;silicic acid?
The canonical SMILES for 2,2-dimethylbutanenitrile;silicic acid is CCC(C)(C)C#N.O[Si](O)(O)O.
What is the InChIKey of 2,2-dimethylbutanenitrile;silicic acid?
The InChIKey is XDXNOAHSSFTMLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.H4O4Si/c1-4-6(2,3)5-7;1-5(2,3)4/h4H2,1-3H3;1-4H.
What are the key properties of 2,2-dimethylbutanenitrile;silicic acid?
2,2-dimethylbutanenitrile;silicic acid has a molecular weight of 193.27 g/mol, XLogP of -0.66, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylbutanenitrile;silicic acid is sourced from PubChem (CID 175510249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).