C12H23NO — CID 134854737
2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile (PubChem CID 134854737) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile.
| Compound Name | 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile |
|---|---|
| PubChem CID | 134854737 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile |
| SMILES | CCCC(C)(O)C(C)C(C)(C#N)CC |
| InChI | InChI=1S/C12H23NO/c1-6-8-12(5,14)10(3)11(4,7-2)9-13/h10,14H,6-8H2,1-5H3 |
| InChIKey | XRURXRSUPCHGKZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |