About 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile
2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile (PubChem CID 134854737) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile.
Molecular Properties
| Compound Name | 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile |
| PubChem CID | 134854737 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile |
| SMILES | CCCC(C)(O)C(C)C(C)(C#N)CC |
| InChI | InChI=1S/C12H23NO/c1-6-8-12(5,14)10(3)11(4,7-2)9-13/h10,14H,6-8H2,1-5H3 |
| InChIKey | XRURXRSUPCHGKZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile?
The IUPAC name of 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile (CID 134854737) is 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile.
What is the SMILES notation for 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile?
The canonical SMILES for 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile is CCCC(C)(O)C(C)C(C)(C#N)CC.
What is the InChIKey of 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile?
The InChIKey is XRURXRSUPCHGKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-6-8-12(5,14)10(3)11(4,7-2)9-13/h10,14H,6-8H2,1-5H3.
What are the key properties of 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile?
2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile has a molecular weight of 197.32 g/mol, XLogP of 3.11, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-hydroxy-2,3,4-trimethylheptanenitrile is sourced from PubChem (CID 134854737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).