C12H21NO — CID 137482752
2,2,6,6-tetramethyl-5-oxooctanenitrile (PubChem CID 137482752) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-5-oxooctanenitrile.
| Compound Name | 2,2,6,6-tetramethyl-5-oxooctanenitrile |
|---|---|
| PubChem CID | 137482752 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2,2,6,6-tetramethyl-5-oxooctanenitrile |
| SMILES | CCC(C)(C)C(=O)CCC(C)(C)C#N |
| InChI | InChI=1S/C12H21NO/c1-6-12(4,5)10(14)7-8-11(2,3)9-13/h6-8H2,1-5H3 |
| InChIKey | OVMMAXNEFAQNKH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |