C15H18F12O — CID 126630313
7,7,8,8,9,9,11,11,11-nonafluoro-3,3,10-trimethyl-10-(trifluoromethyl)undecan-4-one (PubChem CID 126630313) has the molecular formula C15H18F12O and a molecular weight of 442.28 g/mol. Its IUPAC name is 7,7,8,8,9,9,11,11,11-nonafluoro-3,3,10-trimethyl-10-(trifluoromethyl)undecan-4-one.
| Compound Name | 7,7,8,8,9,9,11,11,11-nonafluoro-3,3,10-trimethyl-10-(trifluoromethyl)undecan-4-one |
|---|---|
| PubChem CID | 126630313 |
| Molecular Formula | C15H18F12O |
| Molecular Weight | 442.28 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 7,7,8,8,9,9,11,11,11-nonafluoro-3,3,10-trimethyl-10-(trifluoromethyl)undecan-4-one |
| SMILES | CCC(C)(C)C(=O)CCC(F)(F)C(F)(F)C(F)(F)C(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H18F12O/c1-5-9(2,3)8(28)6-7-11(16,17)13(20,21)12(18,19)10(4,14(22,23)24)15(25,26)27/h5-7H2,1-4H3 |
| InChIKey | QRFWECFTNDGNHN-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.28 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|