C13H22O2 — CID 129132648
(E)-3,8,8-trimethyldec-2-ene-4,7-dione (PubChem CID 129132648) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (E)-3,8,8-trimethyldec-2-ene-4,7-dione.
| Compound Name | (E)-3,8,8-trimethyldec-2-ene-4,7-dione |
|---|---|
| PubChem CID | 129132648 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (E)-3,8,8-trimethyldec-2-ene-4,7-dione |
| SMILES | C/C=C(\C)C(=O)CCC(=O)C(C)(C)CC |
| InChI | InChI=1S/C13H22O2/c1-6-10(3)11(14)8-9-12(15)13(4,5)7-2/h6H,7-9H2,1-5H3/b10-6+ |
| InChIKey | HTOCLBKTKQHMGW-UXBLZVDNSA-N |
| XLogP | 3.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|