About 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile
5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile (PubChem CID 142227156) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile |
| PubChem CID | 142227156 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C)COCCC(O)C(C)(C)C#N |
| InChI | InChI=1S/C12H23NO2/c1-11(2,3)9-15-7-6-10(14)12(4,5)8-13/h10,14H,6-7,9H2,1-5H3 |
| InChIKey | CPRAZGIEGJAHIE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile?
The IUPAC name of 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile (CID 142227156) is 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile.
What is the SMILES notation for 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile?
The canonical SMILES for 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile is CC(C)(C)COCCC(O)C(C)(C)C#N.
What is the InChIKey of 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile?
The InChIKey is CPRAZGIEGJAHIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-11(2,3)9-15-7-6-10(14)12(4,5)8-13/h10,14H,6-7,9H2,1-5H3.
What are the key properties of 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile?
5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile has a molecular weight of 213.32 g/mol, XLogP of 2.35, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile is sourced from PubChem (CID 142227156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).