C12H23NO2 — CID 142227156
5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile (PubChem CID 142227156) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile.
| Compound Name | 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 142227156 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 5-(2,2-dimethylpropoxy)-3-hydroxy-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C)COCCC(O)C(C)(C)C#N |
| InChI | InChI=1S/C12H23NO2/c1-11(2,3)9-15-7-6-10(14)12(4,5)8-13/h10,14H,6-7,9H2,1-5H3 |
| InChIKey | CPRAZGIEGJAHIE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|