About 2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile
2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile (PubChem CID 175077443) has the molecular formula C7H9N3O3
and a molecular weight of 183.17 g/mol. Its IUPAC name is 2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile.
Molecular Properties
| Compound Name | 2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile |
| PubChem CID | 175077443 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile |
| SMILES | C=C(C#N)C#N.NC(CO)C(=O)O |
| InChI | InChI=1S/C4H2N2.C3H7NO3/c1-4(2-5)3-6;4-2(1-5)3(6)7/h1H2;2,5H,1,4H2,(H,6,7) |
| InChIKey | MISDHRIWEWNRPW-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile?
The IUPAC name of 2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile (CID 175077443) is 2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile.
What is the SMILES notation for 2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile?
The canonical SMILES for 2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile is C=C(C#N)C#N.NC(CO)C(=O)O.
What is the InChIKey of 2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile?
The InChIKey is MISDHRIWEWNRPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N2.C3H7NO3/c1-4(2-5)3-6;4-2(1-5)3(6)7/h1H2;2,5H,1,4H2,(H,6,7).
What are the key properties of 2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile?
2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile has a molecular weight of 183.17 g/mol, XLogP of -1.02, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-hydroxypropanoic acid;2-methylidenepropanedinitrile is sourced from PubChem (CID 175077443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).